C12H14Cl3NO3 — CID 7832745
N-[(2R)-1-methoxypropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7832745) has the molecular formula C12H14Cl3NO3 and a molecular weight of 326.61 g/mol. Its IUPAC name is N-[(2R)-1-methoxypropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(2R)-1-methoxypropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7832745 |
| Molecular Formula | C12H14Cl3NO3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | N-[(2R)-1-methoxypropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | COC[C@@H](C)NC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3NO3/c1-7(5-18-2)16-12(17)6-19-11-4-9(14)8(13)3-10(11)15/h3-4,7H,5-6H2,1-2H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | ZWJCKIVCBMWQGN-SSDOTTSWSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|