C12H12Cl3NO5 — CID 43238726
3-hydroxy-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]butanoic acid (PubChem CID 43238726) has the molecular formula C12H12Cl3NO5 and a molecular weight of 356.59 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43238726 |
| Molecular Formula | C12H12Cl3NO5 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 3-hydroxy-2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)COc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H12Cl3NO5/c1-5(17)11(12(19)20)16-10(18)4-21-9-3-7(14)6(13)2-8(9)15/h2-3,5,11,17H,4H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | PBYIZGZBKPZZTO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|