C11H10Cl3NO5 — CID 107833784
(2S)-2-hydroxy-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid (PubChem CID 107833784) has the molecular formula C11H10Cl3NO5 and a molecular weight of 342.56 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 107833784 |
| Molecular Formula | C11H10Cl3NO5 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | (2S)-2-hydroxy-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]propanoic acid |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C11H10Cl3NO5/c12-5-1-7(14)9(2-6(5)13)20-4-10(17)15-3-8(16)11(18)19/h1-2,8,16H,3-4H2,(H,15,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | DQBRAFMOCQHDED-QMMMGPOBSA-N |
| XLogP | 1.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|