C12H13ClFNO5 — CID 107831753
4-[[2-(2-chloro-4-fluorophenoxy)acetyl]amino]-2-hydroxybutanoic acid (PubChem CID 107831753) has the molecular formula C12H13ClFNO5 and a molecular weight of 305.69 g/mol. Its IUPAC name is 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107831753 |
| Molecular Formula | C12H13ClFNO5 |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]amino]-2-hydroxybutanoic acid |
| SMILES | O=C(COc1ccc(F)cc1Cl)NCCC(O)C(=O)O |
| InChI | InChI=1S/C12H13ClFNO5/c13-8-5-7(14)1-2-10(8)20-6-11(17)15-4-3-9(16)12(18)19/h1-2,5,9,16H,3-4,6H2,(H,15,17)(H,18,19) |
| InChIKey | ALOZAODIUYPIJZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |