C11H10Cl2FNO2 — CID 115636624
2-(2-chloro-4-fluorophenoxy)-N-(2-chloroprop-2-enyl)acetamide (PubChem CID 115636624) has the molecular formula C11H10Cl2FNO2 and a molecular weight of 278.11 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-(2-chloroprop-2-enyl)acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-(2-chloroprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 115636624 |
| Molecular Formula | C11H10Cl2FNO2 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-(2-chloroprop-2-enyl)acetamide |
| SMILES | C=C(Cl)CNC(=O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H10Cl2FNO2/c1-7(12)5-15-11(16)6-17-10-3-2-8(14)4-9(10)13/h2-4H,1,5-6H2,(H,15,16) |
| InChIKey | JMDPXJBELWKUCP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |