C15H19ClFNO3 — CID 64868038
2-(2-chloro-4-fluorophenoxy)-N-[(1-hydroxycyclohexyl)methyl]acetamide (PubChem CID 64868038) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[(1-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[(1-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 64868038 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[(1-hydroxycyclohexyl)methyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1Cl)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C15H19ClFNO3/c16-12-8-11(17)4-5-13(12)21-9-14(19)18-10-15(20)6-2-1-3-7-15/h4-5,8,20H,1-3,6-7,9-10H2,(H,18,19) |
| InChIKey | BJSFEXCEFGWRRI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |