C11H12Cl3NO4 — CID 66176024
N-(2,3-dihydroxypropyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 66176024) has the molecular formula C11H12Cl3NO4 and a molecular weight of 328.58 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 66176024 |
| Molecular Formula | C11H12Cl3NO4 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCC(O)CO |
| InChI | InChI=1S/C11H12Cl3NO4/c12-7-1-9(14)10(2-8(7)13)19-5-11(18)15-3-6(17)4-16/h1-2,6,16-17H,3-5H2,(H,15,18) |
| InChIKey | XRAZHWCCSFFPAK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|