C13H14Cl3NO2 — CID 115627905
N-[(E)-pent-3-enyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 115627905) has the molecular formula C13H14Cl3NO2 and a molecular weight of 322.62 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-pent-3-enyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 115627905 |
| Molecular Formula | C13H14Cl3NO2 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[(E)-pent-3-enyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C/C=C/CCNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3NO2/c1-2-3-4-5-17-13(18)8-19-12-7-10(15)9(14)6-11(12)16/h2-3,6-7H,4-5,8H2,1H3,(H,17,18)/b3-2+ |
| InChIKey | RHRNXXBPPVGGGW-NSCUHMNNSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|