C15H15Cl3F3NO6S2 — CID 166422793
3-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422793) has the molecular formula C15H15Cl3F3NO6S2 and a molecular weight of 532.77 g/mol. Its IUPAC name is 3-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422793 |
| Molecular Formula | C15H15Cl3F3NO6S2 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 530.94 |
| IUPAC Name | 3-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3NO4S2.C2HF3O2/c14-8-5-10(16)11(6-9(8)15)21-7-12(18)17-2-4-23-22-3-1-13(19)20;3-2(4,5)1(6)7/h5-6H,1-4,7H2,(H,17,18)(H,19,20);(H,6,7) |
| InChIKey | AEMFFZMEQGARFN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|