C13H15BrClNO4 — CID 79011222
(2R)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-methylbutanoic acid (PubChem CID 79011222) has the molecular formula C13H15BrClNO4 and a molecular weight of 364.62 g/mol. Its IUPAC name is (2R)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79011222 |
| Molecular Formula | C13H15BrClNO4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (2R)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)COc1ccc(Cl)cc1Br)C(=O)O |
| InChI | InChI=1S/C13H15BrClNO4/c1-7(2)12(13(18)19)16-11(17)6-20-10-4-3-8(15)5-9(10)14/h3-5,7,12H,6H2,1-2H3,(H,16,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | PVPCXAIYNCJGGI-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |