C12H13BrClNO5 — CID 9277756
methyl (2S)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-hydroxypropanoate (PubChem CID 9277756) has the molecular formula C12H13BrClNO5 and a molecular weight of 366.60 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277756 |
| Molecular Formula | C12H13BrClNO5 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | methyl (2S)-2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H13BrClNO5/c1-19-12(18)9(5-16)15-11(17)6-20-10-3-2-7(14)4-8(10)13/h2-4,9,16H,5-6H2,1H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | PAZORNPAXYRVMV-VIFPVBQESA-N |
| XLogP | 1.13 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |