C13H13Cl3N2O5 — CID 8785756
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 8785756) has the molecular formula C13H13Cl3N2O5 and a molecular weight of 383.62 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 8785756 |
| Molecular Formula | C13H13Cl3N2O5 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CCNC(=O)NC(=O)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3N2O5/c1-2-17-13(21)18-11(19)5-23-12(20)6-22-10-4-8(15)7(14)3-9(10)16/h3-4H,2,5-6H2,1H3,(H2,17,18,19,21) |
| InChIKey | FZPYGCCFIKLNNG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|