C12H12Cl3NO4 — CID 8933011
2-acetamidoethyl 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 8933011) has the molecular formula C12H12Cl3NO4 and a molecular weight of 340.59 g/mol. Its IUPAC name is 2-acetamidoethyl 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | 2-acetamidoethyl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 8933011 |
| Molecular Formula | C12H12Cl3NO4 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 2-acetamidoethyl 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CC(=O)NCCOC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl3NO4/c1-7(17)16-2-3-19-12(18)6-20-11-5-9(14)8(13)4-10(11)15/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | NFEOQZDDRJBLOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|