C15H10Cl4N2O4 — CID 23818620
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 23818620) has the molecular formula C15H10Cl4N2O4 and a molecular weight of 424.07 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23818620 |
| Molecular Formula | C15H10Cl4N2O4 |
| Molecular Weight | 424.07 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cc(Cl)c(Cl)cc1Cl)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H10Cl4N2O4/c16-8-1-2-13(20-5-8)21-14(22)6-25-15(23)7-24-12-4-10(18)9(17)3-11(12)19/h1-5H,6-7H2,(H,20,21,22) |
| InChIKey | YDWSRELIZOMJHM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.07 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|