C16H10Cl4N2O6 — CID 23851547
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 23851547) has the molecular formula C16H10Cl4N2O6 and a molecular weight of 468.08 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23851547 |
| Molecular Formula | C16H10Cl4N2O6 |
| Molecular Weight | 468.08 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cc(Cl)c(Cl)cc1Cl)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10Cl4N2O6/c17-8-1-2-12(13(3-8)22(25)26)21-15(23)6-28-16(24)7-27-14-5-10(19)9(18)4-11(14)20/h1-5H,6-7H2,(H,21,23) |
| InChIKey | HGPJEJXFWUBPLV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|