C16H11Cl2FN2O5 — CID 7718393
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718393) has the molecular formula C16H11Cl2FN2O5 and a molecular weight of 401.18 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718393 |
| Molecular Formula | C16H11Cl2FN2O5 |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1c(F)cccc1Cl)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11Cl2FN2O5/c17-9-4-5-13(14(6-9)21(24)25)20-15(22)8-26-16(23)7-10-11(18)2-1-3-12(10)19/h1-6H,7-8H2,(H,20,22) |
| InChIKey | CXXAVDVTXLGEMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|