C17H11ClFN3O5 — CID 7718394
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718394) has the molecular formula C17H11ClFN3O5 and a molecular weight of 391.74 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718394 |
| Molecular Formula | C17H11ClFN3O5 |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H11ClFN3O5/c18-13-2-1-3-14(19)12(13)7-17(24)27-9-16(23)21-15-5-4-11(22(25)26)6-10(15)8-20/h1-6H,7,9H2,(H,21,23) |
| InChIKey | SZBQITHRSGAOOV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|