C16H11Cl3N2O6 — CID 5226542
[2-(2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 5226542) has the molecular formula C16H11Cl3N2O6 and a molecular weight of 433.63 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 5226542 |
| Molecular Formula | C16H11Cl3N2O6 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11Cl3N2O6/c17-9-5-11(19)14(6-10(9)18)26-8-16(23)27-7-15(22)20-12-3-1-2-4-13(12)21(24)25/h1-6H,7-8H2,(H,20,22) |
| InChIKey | STARGLJWEIJQSN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|