C16H12Cl2N2O5 — CID 40669347
[2-(2-nitroanilino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 40669347) has the molecular formula C16H12Cl2N2O5 and a molecular weight of 383.19 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 40669347 |
| Molecular Formula | C16H12Cl2N2O5 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(Cl)c(Cl)c1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12Cl2N2O5/c17-11-6-5-10(7-12(11)18)8-16(22)25-9-15(21)19-13-3-1-2-4-14(13)20(23)24/h1-7H,8-9H2,(H,19,21) |
| InChIKey | AZOVFYUFMQWCFN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|