C16H10Cl4O4 — CID 23735344
[2-(4-chlorophenyl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 23735344) has the molecular formula C16H10Cl4O4 and a molecular weight of 408.06 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23735344 |
| Molecular Formula | C16H10Cl4O4 |
| Molecular Weight | 408.06 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)OCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl4O4/c17-10-3-1-9(2-4-10)14(21)7-24-16(22)8-23-15-6-12(19)11(18)5-13(15)20/h1-6H,7-8H2 |
| InChIKey | TYZZWBZXDNJJPT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|