C18H17ClO6 — CID 7750520
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate (PubChem CID 7750520) has the molecular formula C18H17ClO6 and a molecular weight of 364.78 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7750520 |
| Molecular Formula | C18H17ClO6 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)COc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H17ClO6/c1-22-16-8-3-12(9-17(16)23-2)15(20)10-25-18(21)11-24-14-6-4-13(19)5-7-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | QOVJWKLJSIRNMP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |