C19H16BrClO5 — CID 2287210
[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 2287210) has the molecular formula C19H16BrClO5 and a molecular weight of 439.69 g/mol. Its IUPAC name is [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2287210 |
| Molecular Formula | C19H16BrClO5 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCC(=O)c2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C19H16BrClO5/c1-25-18-8-4-13(10-15(18)20)17(23)11-26-19(24)9-7-16(22)12-2-5-14(21)6-3-12/h2-6,8,10H,7,9,11H2,1H3 |
| InChIKey | FCYKSEJPPBBVED-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |