About [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate
[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate (PubChem CID 16525161) has the molecular formula C18H17BrO4
and a molecular weight of 377.23 g/mol. Its IUPAC name is [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate.
Molecular Properties
| Compound Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate |
| PubChem CID | 16525161 |
| Molecular Formula | C18H17BrO4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H17BrO4/c1-3-12-4-6-13(7-5-12)18(21)23-11-16(20)14-8-9-17(22-2)15(19)10-14/h4-10H,3,11H2,1-2H3 |
| InChIKey | PCXXBEXFWXNSHO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate?
The IUPAC name of [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate (CID 16525161) is [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate.
What is the SMILES notation for [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate?
The canonical SMILES for [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate is CCc1ccc(C(=O)OCC(=O)c2ccc(OC)c(Br)c2)cc1.
What is the InChIKey of [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate?
The InChIKey is PCXXBEXFWXNSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrO4/c1-3-12-4-6-13(7-5-12)18(21)23-11-16(20)14-8-9-17(22-2)15(19)10-14/h4-10H,3,11H2,1-2H3.
What are the key properties of [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate?
[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate has a molecular weight of 377.23 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 4-ethylbenzoate is sourced from PubChem (CID 16525161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).