C12H14BrNO3 — CID 94311085
4-(3-bromo-4-methoxyphenyl)-N-methyl-4-oxobutanamide (PubChem CID 94311085) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 4-(3-bromo-4-methoxyphenyl)-N-methyl-4-oxobutanamide.
| Compound Name | 4-(3-bromo-4-methoxyphenyl)-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 94311085 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-(3-bromo-4-methoxyphenyl)-N-methyl-4-oxobutanamide |
| SMILES | CNC(=O)CCC(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C12H14BrNO3/c1-14-12(16)6-4-10(15)8-3-5-11(17-2)9(13)7-8/h3,5,7H,4,6H2,1-2H3,(H,14,16) |
| InChIKey | ALYLXQLDGJEAQH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |