C13H17BrN2O3 — CID 60680952
2-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]-methylamino]-N-methylacetamide (PubChem CID 60680952) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 60680952 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)CC(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O3/c1-15-13(18)8-16(2)7-11(17)9-4-5-12(19-3)10(14)6-9/h4-6H,7-8H2,1-3H3,(H,15,18) |
| InChIKey | LFMUVHFPMPDMCQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |