C16H11Cl3N2O3 — CID 7873938
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7873938) has the molecular formula C16H11Cl3N2O3 and a molecular weight of 385.63 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7873938 |
| Molecular Formula | C16H11Cl3N2O3 |
| Molecular Weight | 385.63 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H11Cl3N2O3/c17-11-3-1-10(13(19)7-11)2-6-16(23)24-9-15(22)21-14-5-4-12(18)8-20-14/h1-8H,9H2,(H,20,21,22)/b6-2+ |
| InChIKey | CDUDGYNSRQWUQD-QHHAFSJGSA-N |
| XLogP | 4.24 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|