C16H12ClN3O5 — CID 5025712
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate (PubChem CID 5025712) has the molecular formula C16H12ClN3O5 and a molecular weight of 361.74 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5025712 |
| Molecular Formula | C16H12ClN3O5 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc([N+](=O)[O-])cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H12ClN3O5/c17-12-4-7-14(18-9-12)19-15(21)10-25-16(22)8-3-11-1-5-13(6-2-11)20(23)24/h1-9H,10H2,(H,18,19,21) |
| InChIKey | IQCXJWKXZLHXLY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|