C17H12ClF3N2O4 — CID 46793180
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate (PubChem CID 46793180) has the molecular formula C17H12ClF3N2O4 and a molecular weight of 400.74 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 46793180 |
| Molecular Formula | C17H12ClF3N2O4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)(F)F)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C17H12ClF3N2O4/c18-12-4-7-14(22-9-12)23-15(24)10-26-16(25)8-3-11-1-5-13(6-2-11)27-17(19,20)21/h1-9H,10H2,(H,22,23,24)/b8-3+ |
| InChIKey | UAUZPIDPHYSMFH-FPYGCLRLSA-N |
| XLogP | 3.83 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|