C15H19Cl3N2O3 — CID 9343613
N-tert-butyl-2-[methyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetamide (PubChem CID 9343613) has the molecular formula C15H19Cl3N2O3 and a molecular weight of 381.69 g/mol. Its IUPAC name is N-tert-butyl-2-[methyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[methyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 9343613 |
| Molecular Formula | C15H19Cl3N2O3 |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-tert-butyl-2-[methyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl3N2O3/c1-15(2,3)19-13(21)7-20(4)14(22)8-23-12-6-10(17)9(16)5-11(12)18/h5-6H,7-8H2,1-4H3,(H,19,21) |
| InChIKey | PGBJWSWOSWDKCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|