C12H13Cl3O2 — CID 60728681
2-(2,4,5-trichlorophenoxy)cyclohexan-1-ol (PubChem CID 60728681) has the molecular formula C12H13Cl3O2 and a molecular weight of 295.59 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)cyclohexan-1-ol.
| Compound Name | 2-(2,4,5-trichlorophenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 60728681 |
| Molecular Formula | C12H13Cl3O2 |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)cyclohexan-1-ol |
| SMILES | OC1CCCCC1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3O2/c13-7-5-9(15)12(6-8(7)14)17-11-4-2-1-3-10(11)16/h5-6,10-11,16H,1-4H2 |
| InChIKey | LDERFXZRBDGRRA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|