C12H14BrClO2 — CID 102732484
trans-(1S,2S)-2-(4-bromo-2-chlorophenoxy)cyclohexan-1-ol (PubChem CID 102732484) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-bromo-2-chlorophenoxy)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(4-bromo-2-chlorophenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732484 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | trans-(1S,2S)-2-(4-bromo-2-chlorophenoxy)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1Oc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrClO2/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15/h5-7,10,12,15H,1-4H2/t10-,12-/m0/s1 |
| InChIKey | VUGFLEZHQTUPLZ-JQWIXIFHSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |