C12H16BrNO2 — CID 60877742
2-[2-(aminomethyl)-4-bromophenoxy]cyclopentan-1-ol (PubChem CID 60877742) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-bromophenoxy]cyclopentan-1-ol.
| Compound Name | 2-[2-(aminomethyl)-4-bromophenoxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 60877742 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-[2-(aminomethyl)-4-bromophenoxy]cyclopentan-1-ol |
| SMILES | NCc1cc(Br)ccc1OC1CCCC1O |
| InChI | InChI=1S/C12H16BrNO2/c13-9-4-5-11(8(6-9)7-14)16-12-3-1-2-10(12)15/h4-6,10,12,15H,1-3,7,14H2 |
| InChIKey | JAJGBAQPPYJBEZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |