C17H20Cl3NO4S — CID 26006663
N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 26006663) has the molecular formula C17H20Cl3NO4S and a molecular weight of 440.78 g/mol. Its IUPAC name is N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 26006663 |
| Molecular Formula | C17H20Cl3NO4S |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | N-cyclopentyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N(C1CCCC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20Cl3NO4S/c18-13-7-15(20)16(8-14(13)19)25-9-17(22)21(11-3-1-2-4-11)12-5-6-26(23,24)10-12/h7-8,11-12H,1-6,9-10H2/t12-/m1/s1 |
| InChIKey | IQMQBVZKYWWVON-GFCCVEGCSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|