C25H30N2O5S — CID 24562064
2-[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 24562064) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 2-[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 24562064 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OCC(=O)N(C1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H30N2O5S/c28-24(27(20-11-5-2-6-12-20)21-15-16-33(30,31)18-21)17-32-23-14-8-7-13-22(23)25(29)26-19-9-3-1-4-10-19/h1,3-4,7-10,13-14,20-21H,2,5-6,11-12,15-18H2,(H,26,29) |
| InChIKey | JAJWQEQEPQEITK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |