C68H104N4O8 — CID 162174733
N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide (PubChem CID 162174733) has the molecular formula C68H104N4O8 and a molecular weight of 1105.60 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide.
| Compound Name | N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide |
|---|---|
| PubChem CID | 162174733 |
| Molecular Formula | C68H104N4O8 |
| Molecular Weight | 1105.60 g/mol |
| Exact Mass | 1104.79 |
| IUPAC Name | N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1OCC(=O)N(C1CCCCC1)C1CCCCC1)N(C1CCCCC1)C1CCCCC1.O=C(COc1ccccc1OCC(=O)N(C1CCCCC1)C1CCCCC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/2C34H52N2O4/c2*37-33(35(27-15-5-1-6-16-27)28-17-7-2-8-18-28)25-39-31-23-13-14-24-32(31)40-26-34(38)36(29-19-9-3-10-20-29)30-21-11-4-12-22-30/h2*13-14,23-24,27-30H,1-12,15-22,25-26H2 |
| InChIKey | ZOFWKDJWBKHCGY-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.60 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |