C34H40N2O4 — CID 102017753
N-cyclohexyl-2-[2-[2-(N-cyclohexylanilino)-2-oxoethoxy]phenoxy]-N-phenylacetamide (PubChem CID 102017753) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-[2-(N-cyclohexylanilino)-2-oxoethoxy]phenoxy]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[2-[2-(N-cyclohexylanilino)-2-oxoethoxy]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 102017753 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | N-cyclohexyl-2-[2-[2-(N-cyclohexylanilino)-2-oxoethoxy]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccccc1OCC(=O)N(c1ccccc1)C1CCCCC1)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C34H40N2O4/c37-33(35(27-15-5-1-6-16-27)28-17-7-2-8-18-28)25-39-31-23-13-14-24-32(31)40-26-34(38)36(29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1,3,5-6,9-10,13-16,19-20,23-24,28,30H,2,4,7-8,11-12,17-18,21-22,25-26H2 |
| InChIKey | DIGIDIRQICCAOW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |