C13H16ClNO — CID 18329458
N-cyclohexyl-N-phenylcarbamoyl chloride (PubChem CID 18329458) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is N-cyclohexyl-N-phenylcarbamoyl chloride.
| Compound Name | N-cyclohexyl-N-phenylcarbamoyl chloride |
|---|---|
| PubChem CID | 18329458 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-cyclohexyl-N-phenylcarbamoyl chloride |
| SMILES | O=C(Cl)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C13H16ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | GCLMSHIGZDHMJD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|