C26H35NO3 — CID 7695229
[2-(N-cyclohexylanilino)-2-oxoethyl] 2-(1-adamantyl)acetate (PubChem CID 7695229) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(1-adamantyl)acetate.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 7695229 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(1-adamantyl)acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OCC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H35NO3/c28-24(27(22-7-3-1-4-8-22)23-9-5-2-6-10-23)18-30-25(29)17-26-14-19-11-20(15-26)13-21(12-19)16-26/h1,3-4,7-8,19-21,23H,2,5-6,9-18H2 |
| InChIKey | KMQGPKNXKSIJFV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |