C22H29N3O5 — CID 7793396
[2-(N-cyclohexylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793396) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793396 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)N(c2ccccc2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C22H29N3O5/c1-3-22(2)20(28)24(21(29)23-22)14-19(27)30-15-18(26)25(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4,6-7,10-11,17H,3,5,8-9,12-15H2,1-2H3,(H,23,29)/t22-/m0/s1 |
| InChIKey | MOVJKRYFJZPNBO-QFIPXVFZSA-N |
| XLogP | 2.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|