C18H24N4O3 — CID 124590764
N-cyclopentyl-2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide (PubChem CID 124590764) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-cyclopentyl-2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide.
| Compound Name | N-cyclopentyl-2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 124590764 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-cyclopentyl-2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide |
| SMILES | CC[C@@]1(C)NC(=O)N(CC(=O)N(c2ccccn2)C2CCCC2)C1=O |
| InChI | InChI=1S/C18H24N4O3/c1-3-18(2)16(24)21(17(25)20-18)12-15(23)22(13-8-4-5-9-13)14-10-6-7-11-19-14/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,20,25)/t18-/m1/s1 |
| InChIKey | RHRVVPMTBQZNJT-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|