C18H31N3O3 — CID 51138912
N-cyclohexyl-N-ethyl-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51138912) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-N-ethyl-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51138912 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-cyclohexyl-N-ethyl-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCN(C(=O)CN1C(=O)NC(C)(CC(C)C)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-5-20(14-9-7-6-8-10-14)15(22)12-21-16(23)18(4,11-13(2)3)19-17(21)24/h13-14H,5-12H2,1-4H3,(H,19,24) |
| InChIKey | BZENZNATAGBSME-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|