C21H29N3O5 — CID 55311172
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 55311172) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55311172 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(C)NC(=O)N(CC(=O)OCC(=O)N(Cc2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C21H29N3O5/c1-6-21(5)18(27)23(19(28)22-21)13-17(26)29-14-16(25)24(20(2,3)4)12-15-10-8-7-9-11-15/h7-11H,6,12-14H2,1-5H3,(H,22,28) |
| InChIKey | JHKWZLCZOQZPTD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|