C17H20N4O6 — CID 8957701
[2-oxo-2-(phenylcarbamoylamino)ethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 8957701) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 8957701 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@@]1(C)NC(=O)N(CC(=O)OCC(=O)NC(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N4O6/c1-3-17(2)14(24)21(16(26)20-17)9-13(23)27-10-12(22)19-15(25)18-11-7-5-4-6-8-11/h4-8H,3,9-10H2,1-2H3,(H,20,26)(H2,18,19,22,25)/t17-/m1/s1 |
| InChIKey | KSWKIXFZEUTVOW-QGZVFWFLSA-N |
| XLogP | 0.60 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|