C24H27NO5 — CID 7902946
[2-(N-cyclohexylanilino)-2-oxoethyl] 2-(3-acetylphenoxy)acetate (PubChem CID 7902946) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(3-acetylphenoxy)acetate.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(3-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 7902946 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(3-acetylphenoxy)acetate |
| SMILES | CC(=O)c1cccc(OCC(=O)OCC(=O)N(c2ccccc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H27NO5/c1-18(26)19-9-8-14-22(15-19)29-17-24(28)30-16-23(27)25(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2,4-5,8-11,14-15,21H,3,6-7,12-13,16-17H2,1H3 |
| InChIKey | MZYRGFMQTDLGFO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |