C25H27NO5 — CID 7901935
[2-(N-cyclohexylanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 7901935) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7901935 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCC(=O)N(c3ccccc3)C3CCCCC3)coc2c1 |
| InChI | InChI=1S/C25H27NO5/c1-29-21-12-13-22-18(16-30-23(22)15-21)14-25(28)31-17-24(27)26(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2,4-5,8-9,12-13,15-16,20H,3,6-7,10-11,14,17H2,1H3 |
| InChIKey | RIPSWLXGGVWQHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |