C21H21Cl2NO3 — CID 7873389
[2-(N-cyclohexylanilino)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 7873389) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7873389 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | O=C(OCC(=O)N(c1ccccc1)C1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2NO3/c22-18-12-11-15(13-19(18)23)21(26)27-14-20(25)24(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1,3-4,7-8,11-13,17H,2,5-6,9-10,14H2 |
| InChIKey | FFJKVUJOPAVBEJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |