C18H17ClN2O5S — CID 7867468
[2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 7867468) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867468 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1)c1cccnc1Cl |
| InChI | InChI=1S/C18H17ClN2O5S/c19-17-15(7-4-9-20-17)18(23)26-11-16(22)21(13-5-2-1-3-6-13)14-8-10-27(24,25)12-14/h1-7,9,14H,8,10-12H2/t14-/m1/s1 |
| InChIKey | VCALEPIYLTXPBW-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|