C18H18ClNO4S — CID 7816188
2-(4-chlorophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide (PubChem CID 7816188) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7816188 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18ClNO4S/c19-14-6-8-17(9-7-14)24-12-18(21)20(15-4-2-1-3-5-15)16-10-11-25(22,23)13-16/h1-9,16H,10-13H2/t16-/m1/s1 |
| InChIKey | JJXWYZHSTGGINN-MRXNPFEDSA-N |
| XLogP | 2.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |