C18H17Cl2NO4S — CID 7503891
2-(2,4-dichlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide (PubChem CID 7503891) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7503891 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N(c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H17Cl2NO4S/c19-13-6-7-17(16(20)10-13)25-11-18(22)21(14-4-2-1-3-5-14)15-8-9-26(23,24)12-15/h1-7,10,15H,8-9,11-12H2/t15-/m0/s1 |
| InChIKey | HNQCFWTTYGZEAX-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |