C25H23ClN2O5S — CID 24578752
5-chloro-2-[2-(N-(1,1-dioxothiolan-3-yl)anilino)-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 24578752) has the molecular formula C25H23ClN2O5S and a molecular weight of 498.99 g/mol. Its IUPAC name is 5-chloro-2-[2-(N-(1,1-dioxothiolan-3-yl)anilino)-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 5-chloro-2-[2-(N-(1,1-dioxothiolan-3-yl)anilino)-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 24578752 |
| Molecular Formula | C25H23ClN2O5S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 5-chloro-2-[2-(N-(1,1-dioxothiolan-3-yl)anilino)-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(Cl)ccc1OCC(=O)N(c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H23ClN2O5S/c26-18-11-12-23(22(15-18)25(30)27-19-7-3-1-4-8-19)33-16-24(29)28(20-9-5-2-6-10-20)21-13-14-34(31,32)17-21/h1-12,15,21H,13-14,16-17H2,(H,27,30) |
| InChIKey | JMEZYHHYQQELLZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |